C36H52O4 — CID 11731322
4-methoxy-6-[(3S,4E,6E,8S,9E,12R)-2,6,8,10,12-pentamethyl-3-phenylmethoxyoctadeca-4,6,9-trien-2-yl]pyran-2-one (PubChem CID 11731322) has the molecular formula C36H52O4 and a molecular weight of 548.81 g/mol. Its IUPAC name is 4-methoxy-6-[(3S,4E,6E,8S,9E,12R)-2,6,8,10,12-pentamethyl-3-phenylmethoxyoctadeca-4,6,9-trien-2-yl]pyran-2-one.
| Compound Name | 4-methoxy-6-[(3S,4E,6E,8S,9E,12R)-2,6,8,10,12-pentamethyl-3-phenylmethoxyoctadeca-4,6,9-trien-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 11731322 |
| Molecular Formula | C36H52O4 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | 4-methoxy-6-[(3S,4E,6E,8S,9E,12R)-2,6,8,10,12-pentamethyl-3-phenylmethoxyoctadeca-4,6,9-trien-2-yl]pyran-2-one |
| SMILES | CCCCCC[C@@H](C)C/C(C)=C/[C@H](C)/C=C(C)/C=C/[C@H](OCc1ccccc1)C(C)(C)c1cc(OC)cc(=O)o1 |
| InChI | InChI=1S/C36H52O4/c1-9-10-11-13-16-27(2)21-29(4)23-30(5)22-28(3)19-20-33(39-26-31-17-14-12-15-18-31)36(6,7)34-24-32(38-8)25-35(37)40-34/h12,14-15,17-20,22-25,27,30,33H,9-11,13,16,21,26H2,1-8H3/b20-19+,28-22+,29-23+/t27-,30-,33+/m1/s1 |
| InChIKey | JYBOFQNLOGMNNM-BQADRVGRSA-N |
| XLogP | 9.59 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|