C33H34O3SSi — CID 11082090
(3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyl-3-phenylsulfanyloxolan-2-one (PubChem CID 11082090) has the molecular formula C33H34O3SSi and a molecular weight of 538.79 g/mol. Its IUPAC name is (3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 11082090 |
| Molecular Formula | C33H34O3SSi |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | (3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyl-3-phenylsulfanyloxolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(=O)[C@@H](Sc2ccccc2)[C@@H]1c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34O3SSi/c1-33(2,3)38(27-20-12-6-13-21-27,28-22-14-7-15-23-28)35-24-29-30(25-16-8-4-9-17-25)31(32(34)36-29)37-26-18-10-5-11-19-26/h4-23,29-31H,24H2,1-3H3/t29-,30-,31+/m1/s1 |
| InChIKey | MYTPXLBCBDIDOJ-OLUZHXLYSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|