C27H30O3Si — CID 11553759
(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyloxolan-2-one (PubChem CID 11553759) has the molecular formula C27H30O3Si and a molecular weight of 430.62 g/mol. Its IUPAC name is (4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyloxolan-2-one.
| Compound Name | (4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 11553759 |
| Molecular Formula | C27H30O3Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenyloxolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(=O)C[C@@H]1c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O3Si/c1-27(2,3)31(22-15-9-5-10-16-22,23-17-11-6-12-18-23)29-20-25-24(19-26(28)30-25)21-13-7-4-8-14-21/h4-18,24-25H,19-20H2,1-3H3/t24-,25-/m1/s1 |
| InChIKey | VYZCCVDIDDUWNH-JWQCQUIFSA-N |
| XLogP | 4.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|