C36H30O10 — CID 11082676
7,11,13,16,18,22-hexahydroxy-5,24-dimethoxy-6,23-di(propan-2-yl)heptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3,5,7,10,12,14(28),15(27),16,18,21,23,25-tridecaene-9,20-dione (PubChem CID 11082676) has the molecular formula C36H30O10 and a molecular weight of 622.63 g/mol. Its IUPAC name is 7,11,13,16,18,22-hexahydroxy-5,24-dimethoxy-6,23-di(propan-2-yl)heptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3,5,7,10,12,14(28),15(27),16,18,21,23,25-tridecaene-9,20-dione.
| Compound Name | 7,11,13,16,18,22-hexahydroxy-5,24-dimethoxy-6,23-di(propan-2-yl)heptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3,5,7,10,12,14(28),15(27),16,18,21,23,25-tridecaene-9,20-dione |
|---|---|
| PubChem CID | 11082676 |
| Molecular Formula | C36H30O10 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | 7,11,13,16,18,22-hexahydroxy-5,24-dimethoxy-6,23-di(propan-2-yl)heptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3,5,7,10,12,14(28),15(27),16,18,21,23,25-tridecaene-9,20-dione |
| SMILES | COc1cc2c(c(O)c1C(C)C)c(=O)c1c(O)cc(O)c3c4c(O)cc(O)c5c(=O)c6c(O)c(C(C)C)c(OC)cc6c(c54)c2c13 |
| InChI | InChI=1S/C36H30O10/c1-11(2)21-19(45-5)7-13-23-24-14-8-20(46-6)22(12(3)4)34(42)26(14)36(44)30-18(40)10-16(38)28(32(24)30)27-15(37)9-17(39)29(31(23)27)35(43)25(13)33(21)41/h7-12,37-42H,1-6H3 |
| InChIKey | GOQFKRQVZYDKDT-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|