C14H11NO5 — CID 14734323
1,6,8-trihydroxy-2-methoxy-10H-acridin-9-one (PubChem CID 14734323) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is 1,6,8-trihydroxy-2-methoxy-10H-acridin-9-one.
| Compound Name | 1,6,8-trihydroxy-2-methoxy-10H-acridin-9-one |
|---|---|
| PubChem CID | 14734323 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1,6,8-trihydroxy-2-methoxy-10H-acridin-9-one |
| SMILES | COc1ccc2[nH]c3cc(O)cc(O)c3c(=O)c2c1O |
| InChI | InChI=1S/C14H11NO5/c1-20-10-3-2-7-12(13(10)18)14(19)11-8(15-7)4-6(16)5-9(11)17/h2-5,16-18H,1H3,(H,15,19) |
| InChIKey | ZMXYNMSNMSHWTR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|