About 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid
2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid (PubChem CID 110832036) has the molecular formula C15H11BrN2O4
and a molecular weight of 363.17 g/mol. Its IUPAC name is 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid |
| PubChem CID | 110832036 |
| Molecular Formula | C15H11BrN2O4 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CN1C(=O)COc2ccc(Br)nc21 |
| InChI | InChI=1S/C15H11BrN2O4/c16-12-6-5-11-14(17-12)18(13(19)8-22-11)7-9-3-1-2-4-10(9)15(20)21/h1-6H,7-8H2,(H,20,21) |
| InChIKey | QEBSNWCDUHPVJI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid?
The IUPAC name of 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid (CID 110832036) is 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid.
What is the SMILES notation for 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid?
The canonical SMILES for 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid is O=C(O)c1ccccc1CN1C(=O)COc2ccc(Br)nc21.
What is the InChIKey of 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid?
The InChIKey is QEBSNWCDUHPVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrN2O4/c16-12-6-5-11-14(17-12)18(13(19)8-22-11)7-9-3-1-2-4-10(9)15(20)21/h1-6H,7-8H2,(H,20,21).
What are the key properties of 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid?
2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid has a molecular weight of 363.17 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-bromo-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl]benzoic acid is sourced from PubChem (CID 110832036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).