C17H19N3O3 — CID 110831575
6-amino-4-(4-phenoxybutyl)pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 110831575) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 6-amino-4-(4-phenoxybutyl)pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-amino-4-(4-phenoxybutyl)pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 110831575 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 6-amino-4-(4-phenoxybutyl)pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | Nc1ccc2c(n1)N(CCCCOc1ccccc1)C(=O)CO2 |
| InChI | InChI=1S/C17H19N3O3/c18-15-9-8-14-17(19-15)20(16(21)12-23-14)10-4-5-11-22-13-6-2-1-3-7-13/h1-3,6-9H,4-5,10-12H2,(H2,18,19) |
| InChIKey | HRGDYIQAVBLLIV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|