C8H10N3O6P — CID 118365702
(6-amino-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl dihydrogen phosphate (PubChem CID 118365702) has the molecular formula C8H10N3O6P and a molecular weight of 275.16 g/mol. Its IUPAC name is (6-amino-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl dihydrogen phosphate.
| Compound Name | (6-amino-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118365702 |
| Molecular Formula | C8H10N3O6P |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | (6-amino-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)methyl dihydrogen phosphate |
| SMILES | Nc1ccc2c(n1)N(COP(=O)(O)O)C(=O)CO2 |
| InChI | InChI=1S/C8H10N3O6P/c9-6-2-1-5-8(10-6)11(7(12)3-16-5)4-17-18(13,14)15/h1-2H,3-4H2,(H2,9,10)(H2,13,14,15) |
| InChIKey | UBKWFACEKNFLLG-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|