C19H28N4O5Si — CID 168771445
6-(2-amino-6-oxo-5-oxa-7-azaspiro[3.4]octan-7-yl)-4-(2-trimethylsilylethoxymethyl)pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 168771445) has the molecular formula C19H28N4O5Si and a molecular weight of 420.54 g/mol. Its IUPAC name is 6-(2-amino-6-oxo-5-oxa-7-azaspiro[3.4]octan-7-yl)-4-(2-trimethylsilylethoxymethyl)pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-(2-amino-6-oxo-5-oxa-7-azaspiro[3.4]octan-7-yl)-4-(2-trimethylsilylethoxymethyl)pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 168771445 |
| Molecular Formula | C19H28N4O5Si |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 6-(2-amino-6-oxo-5-oxa-7-azaspiro[3.4]octan-7-yl)-4-(2-trimethylsilylethoxymethyl)pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | C[Si](C)(C)CCOCN1C(=O)COc2ccc(N3CC4(CC(N)C4)OC3=O)nc21 |
| InChI | InChI=1S/C19H28N4O5Si/c1-29(2,3)7-6-26-12-23-16(24)10-27-14-4-5-15(21-17(14)23)22-11-19(28-18(22)25)8-13(20)9-19/h4-5,13H,6-12,20H2,1-3H3 |
| InChIKey | PUGMWNXVDWKAAR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|