C14H27BrN2O3Si — CID 140886182
1-(5-bromopentyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione (PubChem CID 140886182) has the molecular formula C14H27BrN2O3Si and a molecular weight of 379.37 g/mol. Its IUPAC name is 1-(5-bromopentyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione.
| Compound Name | 1-(5-bromopentyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140886182 |
| Molecular Formula | C14H27BrN2O3Si |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-(5-bromopentyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
| SMILES | C[Si](C)(C)CCOCN1C(=O)CN(CCCCCBr)C1=O |
| InChI | InChI=1S/C14H27BrN2O3Si/c1-21(2,3)10-9-20-12-17-13(18)11-16(14(17)19)8-6-4-5-7-15/h4-12H2,1-3H3 |
| InChIKey | UKMPCINBICIKJP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|