C19H27N5O4Si — CID 156862807
2-[[5-oxo-1-[3-oxo-4-(2-trimethylsilylethoxymethyl)pyrido[3,2-b][1,4]oxazin-6-yl]pyrrolidin-3-yl]amino]acetonitrile (PubChem CID 156862807) has the molecular formula C19H27N5O4Si and a molecular weight of 417.54 g/mol. Its IUPAC name is 2-[[5-oxo-1-[3-oxo-4-(2-trimethylsilylethoxymethyl)pyrido[3,2-b][1,4]oxazin-6-yl]pyrrolidin-3-yl]amino]acetonitrile.
| Compound Name | 2-[[5-oxo-1-[3-oxo-4-(2-trimethylsilylethoxymethyl)pyrido[3,2-b][1,4]oxazin-6-yl]pyrrolidin-3-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 156862807 |
| Molecular Formula | C19H27N5O4Si |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[[5-oxo-1-[3-oxo-4-(2-trimethylsilylethoxymethyl)pyrido[3,2-b][1,4]oxazin-6-yl]pyrrolidin-3-yl]amino]acetonitrile |
| SMILES | C[Si](C)(C)CCOCN1C(=O)COc2ccc(N3CC(NCC#N)CC3=O)nc21 |
| InChI | InChI=1S/C19H27N5O4Si/c1-29(2,3)9-8-27-13-24-18(26)12-28-15-4-5-16(22-19(15)24)23-11-14(10-17(23)25)21-7-6-20/h4-5,14,21H,7-13H2,1-3H3 |
| InChIKey | RSRLTMJFIPFEMB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|