C27H46N4O6Si2 — CID 156862561
tert-butyl N-[4-[tert-butyl(dimethyl)silyl]oxybut-1-ynyl]-N-[3-oxo-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-6-yl]carbamate (PubChem CID 156862561) has the molecular formula C27H46N4O6Si2 and a molecular weight of 578.86 g/mol. Its IUPAC name is tert-butyl N-[4-[tert-butyl(dimethyl)silyl]oxybut-1-ynyl]-N-[3-oxo-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-6-yl]carbamate.
| Compound Name | tert-butyl N-[4-[tert-butyl(dimethyl)silyl]oxybut-1-ynyl]-N-[3-oxo-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 156862561 |
| Molecular Formula | C27H46N4O6Si2 |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | tert-butyl N-[4-[tert-butyl(dimethyl)silyl]oxybut-1-ynyl]-N-[3-oxo-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C#CCCO[Si](C)(C)C(C)(C)C)c1cnc2c(n1)N(COCC[Si](C)(C)C)C(=O)CO2 |
| InChI | InChI=1S/C27H46N4O6Si2/c1-26(2,3)37-25(33)30(14-12-13-15-36-39(10,11)27(4,5)6)21-18-28-24-23(29-21)31(22(32)19-35-24)20-34-16-17-38(7,8)9/h18H,13,15-17,19-20H2,1-11H3 |
| InChIKey | ZFLIGLVXXRFCDY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|