C16H26N6O5Si — CID 174067376
6-[5-(2-aminoethyl)-2-hydroxy-2H-1,3,4-oxadiazol-3-yl]-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-3-one (PubChem CID 174067376) has the molecular formula C16H26N6O5Si and a molecular weight of 410.51 g/mol. Its IUPAC name is 6-[5-(2-aminoethyl)-2-hydroxy-2H-1,3,4-oxadiazol-3-yl]-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-3-one.
| Compound Name | 6-[5-(2-aminoethyl)-2-hydroxy-2H-1,3,4-oxadiazol-3-yl]-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 174067376 |
| Molecular Formula | C16H26N6O5Si |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 6-[5-(2-aminoethyl)-2-hydroxy-2H-1,3,4-oxadiazol-3-yl]-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-3-one |
| SMILES | C[Si](C)(C)CCOCN1C(=O)COc2ncc(N3N=C(CCN)OC3O)nc21 |
| InChI | InChI=1S/C16H26N6O5Si/c1-28(2,3)7-6-25-10-21-13(23)9-26-15-14(21)19-11(8-18-15)22-16(24)27-12(20-22)4-5-17/h8,16,24H,4-7,9-10,17H2,1-3H3 |
| InChIKey | QTECKRDUCAYNOF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|