C18H26N4O5Si — CID 156862436
6-(2-oxo-5-prop-2-enyl-1,3-oxazolidin-3-yl)-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-3-one (PubChem CID 156862436) has the molecular formula C18H26N4O5Si and a molecular weight of 406.52 g/mol. Its IUPAC name is 6-(2-oxo-5-prop-2-enyl-1,3-oxazolidin-3-yl)-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-3-one.
| Compound Name | 6-(2-oxo-5-prop-2-enyl-1,3-oxazolidin-3-yl)-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 156862436 |
| Molecular Formula | C18H26N4O5Si |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 6-(2-oxo-5-prop-2-enyl-1,3-oxazolidin-3-yl)-4-(2-trimethylsilylethoxymethyl)pyrazino[2,3-b][1,4]oxazin-3-one |
| SMILES | C=CCC1CN(c2cnc3c(n2)N(COCC[Si](C)(C)C)C(=O)CO3)C(=O)O1 |
| InChI | InChI=1S/C18H26N4O5Si/c1-5-6-13-10-21(18(24)27-13)14-9-19-17-16(20-14)22(15(23)11-26-17)12-25-7-8-28(2,3)4/h5,9,13H,1,6-8,10-12H2,2-4H3 |
| InChIKey | UIWMDYYRBUQACC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|