C27H43N5O9Si- — CID 167514482
CID 167514482 (PubChem CID 167514482) has the molecular formula C27H43N5O9Si- and a molecular weight of 609.75 g/mol.
| Compound Name | CID 167514482 |
|---|---|
| PubChem CID | 167514482 |
| Molecular Formula | C27H43N5O9Si- |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N(CC[C@H]1CN(c2cnc3c(n2)N(COCC[Si-](C)(C)C)C(=O)CO3)C(=O)O1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H43N5O9Si/c1-26(2,3)40-24(35)30(25(36)41-27(4,5)6)11-10-18-15-31(23(34)39-18)19-14-28-22-21(29-19)32(20(33)16-38-22)17-37-12-13-42(7,8)9/h14,18H,10-13,15-17H2,1-9H3/q-1/t18-/m0/s1 |
| InChIKey | OAXGLHBNCBAXKP-SFHVURJKSA-N |
| XLogP | 4.40 |
| TPSA | 149.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|