C8H9N3O5 — CID 110835000
(2S)-4-amino-2-(1,2-oxazole-4-carbonylamino)-4-oxobutanoic acid (PubChem CID 110835000) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is (2S)-4-amino-2-(1,2-oxazole-4-carbonylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-(1,2-oxazole-4-carbonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 110835000 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | (2S)-4-amino-2-(1,2-oxazole-4-carbonylamino)-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)c1cnoc1)C(=O)O |
| InChI | InChI=1S/C8H9N3O5/c9-6(12)1-5(8(14)15)11-7(13)4-2-10-16-3-4/h2-3,5H,1H2,(H2,9,12)(H,11,13)(H,14,15)/t5-/m0/s1 |
| InChIKey | PLJUUVKQHCDPOY-YFKPBYRVSA-N |
| XLogP | -1.27 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |