C10H13N3OS — CID 110855193
N,N-diethylimidazo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 110855193) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is N,N-diethylimidazo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N,N-diethylimidazo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 110855193 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N,N-diethylimidazo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1csc2nccn12 |
| InChI | InChI=1S/C10H13N3OS/c1-3-12(4-2)9(14)8-7-15-10-11-5-6-13(8)10/h5-7H,3-4H2,1-2H3 |
| InChIKey | KNLZMSJUVZPGIM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |