C16H19N3O2S — CID 110896761
1-benzyl-3-(4-cyclopropyl-1,3-thiazol-2-yl)-1-(2-hydroxyethyl)urea (PubChem CID 110896761) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-benzyl-3-(4-cyclopropyl-1,3-thiazol-2-yl)-1-(2-hydroxyethyl)urea.
| Compound Name | 1-benzyl-3-(4-cyclopropyl-1,3-thiazol-2-yl)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110896761 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-benzyl-3-(4-cyclopropyl-1,3-thiazol-2-yl)-1-(2-hydroxyethyl)urea |
| SMILES | O=C(Nc1nc(C2CC2)cs1)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C16H19N3O2S/c20-9-8-19(10-12-4-2-1-3-5-12)16(21)18-15-17-14(11-22-15)13-6-7-13/h1-5,11,13,20H,6-10H2,(H,17,18,21) |
| InChIKey | PPGSETCSWVEHAG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |