C14H18F3IN4O2 — CID 110913513
2-[[amino-(oxolan-2-ylmethylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 110913513) has the molecular formula C14H18F3IN4O2 and a molecular weight of 458.22 g/mol. Its IUPAC name is 2-[[amino-(oxolan-2-ylmethylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-(oxolan-2-ylmethylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110913513 |
| Molecular Formula | C14H18F3IN4O2 |
| Molecular Weight | 458.22 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 2-[[amino-(oxolan-2-ylmethylamino)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)NCC1CCCO1 |
| InChI | InChI=1S/C14H17F3N4O2.HI/c15-9-3-4-10(13(17)12(9)16)21-11(22)7-20-14(18)19-6-8-2-1-5-23-8;/h3-4,8H,1-2,5-7H2,(H,21,22)(H3,18,19,20);1H |
| InChIKey | AHGGSEHHDMEBFX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|