C12H21IN4 — CID 110915972
2-(2-anilino-3-methylbutyl)guanidine;hydroiodide (PubChem CID 110915972) has the molecular formula C12H21IN4 and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-(2-anilino-3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 2-(2-anilino-3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110915972 |
| Molecular Formula | C12H21IN4 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-(2-anilino-3-methylbutyl)guanidine;hydroiodide |
| SMILES | CC(C)C(CN=C(N)N)Nc1ccccc1.I |
| InChI | InChI=1S/C12H20N4.HI/c1-9(2)11(8-15-12(13)14)16-10-6-4-3-5-7-10;/h3-7,9,11,16H,8H2,1-2H3,(H4,13,14,15);1H |
| InChIKey | DFPAXCYLONCSHC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|