C29H41NO4Si — CID 11092252
tert-butyl 3-[tert-butyl(diphenyl)silyl]oxy-2-(oxiran-2-ylmethyl)piperidine-1-carboxylate (PubChem CID 11092252) has the molecular formula C29H41NO4Si and a molecular weight of 495.74 g/mol. Its IUPAC name is tert-butyl 3-[tert-butyl(diphenyl)silyl]oxy-2-(oxiran-2-ylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[tert-butyl(diphenyl)silyl]oxy-2-(oxiran-2-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11092252 |
| Molecular Formula | C29H41NO4Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl 3-[tert-butyl(diphenyl)silyl]oxy-2-(oxiran-2-ylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1CC1CO1 |
| InChI | InChI=1S/C29H41NO4Si/c1-28(2,3)33-27(31)30-19-13-18-26(25(30)20-22-21-32-22)34-35(29(4,5)6,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h7-12,14-17,22,25-26H,13,18-21H2,1-6H3 |
| InChIKey | TXRQZXCHHKRJJD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|