About 2-bromo-N,N-diethylbutanamide
2-bromo-N,N-diethylbutanamide (PubChem CID 11096175) has the molecular formula C8H16BrNO
and a molecular weight of 222.13 g/mol. Its IUPAC name is 2-bromo-N,N-diethylbutanamide.
Molecular Properties
| Compound Name | 2-bromo-N,N-diethylbutanamide |
| PubChem CID | 11096175 |
| Molecular Formula | C8H16BrNO |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-bromo-N,N-diethylbutanamide |
| SMILES | CCC(Br)C(=O)N(CC)CC |
| InChI | InChI=1S/C8H16BrNO/c1-4-7(9)8(11)10(5-2)6-3/h7H,4-6H2,1-3H3 |
| InChIKey | HCCISENHKZNNDZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N,N-diethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N,N-diethylbutanamide?
The IUPAC name of 2-bromo-N,N-diethylbutanamide (CID 11096175) is 2-bromo-N,N-diethylbutanamide.
What is the SMILES notation for 2-bromo-N,N-diethylbutanamide?
The canonical SMILES for 2-bromo-N,N-diethylbutanamide is CCC(Br)C(=O)N(CC)CC.
What is the InChIKey of 2-bromo-N,N-diethylbutanamide?
The InChIKey is HCCISENHKZNNDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16BrNO/c1-4-7(9)8(11)10(5-2)6-3/h7H,4-6H2,1-3H3.
What are the key properties of 2-bromo-N,N-diethylbutanamide?
2-bromo-N,N-diethylbutanamide has a molecular weight of 222.13 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N,N-diethylbutanamide is sourced from PubChem (CID 11096175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).