C19H29ClN4O — CID 110962793
4-acetyl-N'-[2-(3-chlorophenyl)-2-methylpropyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 110962793) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is 4-acetyl-N'-[2-(3-chlorophenyl)-2-methylpropyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-[2-(3-chlorophenyl)-2-methylpropyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110962793 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-acetyl-N'-[2-(3-chlorophenyl)-2-methylpropyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccc(Cl)c1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H29ClN4O/c1-5-21-18(24-11-9-23(10-12-24)15(2)25)22-14-19(3,4)16-7-6-8-17(20)13-16/h6-8,13H,5,9-12,14H2,1-4H3,(H,21,22) |
| InChIKey | IECSZOAJMSEOMQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|