C19H28Cl2N4O — CID 110963119
4-acetyl-N'-[2-(3,4-dichlorophenyl)-2-methylpropyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 110963119) has the molecular formula C19H28Cl2N4O and a molecular weight of 399.37 g/mol. Its IUPAC name is 4-acetyl-N'-[2-(3,4-dichlorophenyl)-2-methylpropyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-[2-(3,4-dichlorophenyl)-2-methylpropyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963119 |
| Molecular Formula | C19H28Cl2N4O |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 4-acetyl-N'-[2-(3,4-dichlorophenyl)-2-methylpropyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(Cl)c(Cl)c1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H28Cl2N4O/c1-5-22-18(25-10-8-24(9-11-25)14(2)26)23-13-19(3,4)15-6-7-16(20)17(21)12-15/h6-7,12H,5,8-11,13H2,1-4H3,(H,22,23) |
| InChIKey | PVUJQLPNGPMRIQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|