C13H27N5 — CID 110981207
2-methyl-1-[2-(4-methylpiperazin-1-yl)propyl]-3-prop-2-enylguanidine (PubChem CID 110981207) has the molecular formula C13H27N5 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylpiperazin-1-yl)propyl]-3-prop-2-enylguanidine.
| Compound Name | 2-methyl-1-[2-(4-methylpiperazin-1-yl)propyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110981207 |
| Molecular Formula | C13H27N5 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.23 |
| IUPAC Name | 2-methyl-1-[2-(4-methylpiperazin-1-yl)propyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\C)NCC(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C13H27N5/c1-5-6-15-13(14-3)16-11-12(2)18-9-7-17(4)8-10-18/h5,12H,1,6-11H2,2-4H3,(H2,14,15,16) |
| InChIKey | AAVAYENTARYDLP-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|