C22H25F3N6 — CID 111013809
2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]guanidine (PubChem CID 111013809) has the molecular formula C22H25F3N6 and a molecular weight of 430.48 g/mol. Its IUPAC name is 2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]guanidine.
| Compound Name | 2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]guanidine |
|---|---|
| PubChem CID | 111013809 |
| Molecular Formula | C22H25F3N6 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1nnc2ccccn12)NCC1(c2cccc(C(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C22H25F3N6/c1-26-20(27-14-19-30-29-18-9-2-5-12-31(18)19)28-15-21(10-3-4-11-21)16-7-6-8-17(13-16)22(23,24)25/h2,5-9,12-13H,3-4,10-11,14-15H2,1H3,(H2,26,27,28) |
| InChIKey | DHVBSZFNKJMYRO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|