C14H21IN6OS — CID 119149730
1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 119149730) has the molecular formula C14H21IN6OS and a molecular weight of 448.33 g/mol. Its IUPAC name is 1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119149730 |
| Molecular Formula | C14H21IN6OS |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2ccccn12)NCC1(O)CCSC1.I |
| InChI | InChI=1S/C14H20N6OS.HI/c1-15-13(17-9-14(21)5-7-22-10-14)16-8-12-19-18-11-4-2-3-6-20(11)12;/h2-4,6,21H,5,7-10H2,1H3,(H2,15,16,17);1H |
| InChIKey | SMOTUDFPDBTFRN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|