C27H33N3 — CID 11101418
4-[3,3-bis[4-(dimethylamino)phenyl]prop-2-enyl]-N,N-dimethylaniline (PubChem CID 11101418) has the molecular formula C27H33N3 and a molecular weight of 399.58 g/mol. Its IUPAC name is 4-[3,3-bis[4-(dimethylamino)phenyl]prop-2-enyl]-N,N-dimethylaniline.
| Compound Name | 4-[3,3-bis[4-(dimethylamino)phenyl]prop-2-enyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11101418 |
| Molecular Formula | C27H33N3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 4-[3,3-bis[4-(dimethylamino)phenyl]prop-2-enyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CC=C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H33N3/c1-28(2)24-14-7-21(8-15-24)9-20-27(22-10-16-25(17-11-22)29(3)4)23-12-18-26(19-13-23)30(5)6/h7-8,10-20H,9H2,1-6H3 |
| InChIKey | MFFIPSZLDZQTRF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|