C19H26F3N3O5 — CID 11103577
benzyl (2S)-3-methyl-2-[[4,4,4-trifluoro-3-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]butanoyl]amino]butanoate (PubChem CID 11103577) has the molecular formula C19H26F3N3O5 and a molecular weight of 433.43 g/mol. Its IUPAC name is benzyl (2S)-3-methyl-2-[[4,4,4-trifluoro-3-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]butanoyl]amino]butanoate.
| Compound Name | benzyl (2S)-3-methyl-2-[[4,4,4-trifluoro-3-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 11103577 |
| Molecular Formula | C19H26F3N3O5 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | benzyl (2S)-3-methyl-2-[[4,4,4-trifluoro-3-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]butanoyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)CC(N[C@@H](C)C(=O)NO)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26F3N3O5/c1-11(2)16(18(28)30-10-13-7-5-4-6-8-13)24-15(26)9-14(19(20,21)22)23-12(3)17(27)25-29/h4-8,11-12,14,16,23,29H,9-10H2,1-3H3,(H,24,26)(H,25,27)/t12-,14?,16-/m0/s1 |
| InChIKey | MTBFVLYWHUOKDV-PDULFRILSA-N |
| XLogP | 1.68 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|