C11H18F3N3O5 — CID 10939159
methyl (2S)-2-[[4,4,4-trifluoro-3-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]butanoyl]amino]propanoate (PubChem CID 10939159) has the molecular formula C11H18F3N3O5 and a molecular weight of 329.28 g/mol. Its IUPAC name is methyl (2S)-2-[[4,4,4-trifluoro-3-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]butanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[4,4,4-trifluoro-3-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 10939159 |
| Molecular Formula | C11H18F3N3O5 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | methyl (2S)-2-[[4,4,4-trifluoro-3-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]butanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)CC(N[C@@H](C)C(=O)NO)C(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O5/c1-5(9(19)17-21)15-7(11(12,13)14)4-8(18)16-6(2)10(20)22-3/h5-7,15,21H,4H2,1-3H3,(H,16,18)(H,17,19)/t5-,6-,7?/m0/s1 |
| InChIKey | KJFUTUOPPXSIHA-WABBHOIFSA-N |
| XLogP | -0.53 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|