C9H17F3N2O — CID 88589073
3-(ethylamino)-4,4,4-trifluoro-N-propan-2-ylbutanamide (PubChem CID 88589073) has the molecular formula C9H17F3N2O and a molecular weight of 226.24 g/mol. Its IUPAC name is 3-(ethylamino)-4,4,4-trifluoro-N-propan-2-ylbutanamide.
| Compound Name | 3-(ethylamino)-4,4,4-trifluoro-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 88589073 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-(ethylamino)-4,4,4-trifluoro-N-propan-2-ylbutanamide |
| SMILES | CCNC(CC(=O)NC(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O/c1-4-13-7(9(10,11)12)5-8(15)14-6(2)3/h6-7,13H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | WRXFVPNBGITIFF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |