C11H19F3N4O — CID 111085491
N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]morpholine-4-carboximidamide (PubChem CID 111085491) has the molecular formula C11H19F3N4O and a molecular weight of 280.29 g/mol. Its IUPAC name is N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]morpholine-4-carboximidamide.
| Compound Name | N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111085491 |
| Molecular Formula | C11H19F3N4O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\C1CCN(CC(F)(F)F)C1)N1CCOCC1 |
| InChI | InChI=1S/C11H19F3N4O/c12-11(13,14)8-17-2-1-9(7-17)16-10(15)18-3-5-19-6-4-18/h9H,1-8H2,(H2,15,16) |
| InChIKey | YMAAJZKHXSOQMF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|