C16H23IN4S — CID 111097864
1-(3,4-dimethylphenyl)-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111097864) has the molecular formula C16H23IN4S and a molecular weight of 430.36 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111097864 |
| Molecular Formula | C16H23IN4S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | Cc1csc(CCC/N=C(\N)Nc2ccc(C)c(C)c2)n1.I |
| InChI | InChI=1S/C16H22N4S.HI/c1-11-6-7-14(9-12(11)2)20-16(17)18-8-4-5-15-19-13(3)10-21-15;/h6-7,9-10H,4-5,8H2,1-3H3,(H3,17,18,20);1H |
| InChIKey | QFAPVXDHBODWLK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|