About benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide
benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide (PubChem CID 111099749) has the molecular formula C20H26IN3O2
and a molecular weight of 467.35 g/mol. Its IUPAC name is benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide.
Molecular Properties
| Compound Name | benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide |
| PubChem CID | 111099749 |
| Molecular Formula | C20H26IN3O2 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide |
| SMILES | CN(C)C(=NCc1cccc(C(=O)OCc2ccccc2)c1)N(C)C.I |
| InChI | InChI=1S/C20H25N3O2.HI/c1-22(2)20(23(3)4)21-14-17-11-8-12-18(13-17)19(24)25-15-16-9-6-5-7-10-16;/h5-13H,14-15H2,1-4H3;1H |
| InChIKey | CAEOURAKQZZFMT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide?
The IUPAC name of benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide (CID 111099749) is benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide.
What is the SMILES notation for benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide?
The canonical SMILES for benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide is CN(C)C(=NCc1cccc(C(=O)OCc2ccccc2)c1)N(C)C.I.
What is the InChIKey of benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide?
The InChIKey is CAEOURAKQZZFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O2.HI/c1-22(2)20(23(3)4)21-14-17-11-8-12-18(13-17)19(24)25-15-16-9-6-5-7-10-16;/h5-13H,14-15H2,1-4H3;1H.
What are the key properties of benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide?
benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide has a molecular weight of 467.35 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-[[bis(dimethylamino)methylideneamino]methyl]benzoate;hydroiodide is sourced from PubChem (CID 111099749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).