C17H24N6O — CID 111101583
N'-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111101583) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is N'-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111101583 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N'-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | COc1ccc(-c2n[nH]c(C/N=C(\N)N3CCCC(C)C3)n2)cc1 |
| InChI | InChI=1S/C17H24N6O/c1-12-4-3-9-23(11-12)17(18)19-10-15-20-16(22-21-15)13-5-7-14(24-2)8-6-13/h5-8,12H,3-4,9-11H2,1-2H3,(H2,18,19)(H,20,21,22) |
| InChIKey | GMHHDEHKZZXHOH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|