C22H27NSi — CID 11110405
(4,5-diphenyl-1-propylpyrrol-3-yl)-trimethylsilane (PubChem CID 11110405) has the molecular formula C22H27NSi and a molecular weight of 333.55 g/mol. Its IUPAC name is (4,5-diphenyl-1-propylpyrrol-3-yl)-trimethylsilane.
| Compound Name | (4,5-diphenyl-1-propylpyrrol-3-yl)-trimethylsilane |
|---|---|
| PubChem CID | 11110405 |
| Molecular Formula | C22H27NSi |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (4,5-diphenyl-1-propylpyrrol-3-yl)-trimethylsilane |
| SMILES | CCCn1cc([Si](C)(C)C)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H27NSi/c1-5-16-23-17-20(24(2,3)4)21(18-12-8-6-9-13-18)22(23)19-14-10-7-11-15-19/h6-15,17H,5,16H2,1-4H3 |
| InChIKey | AQWJBMMCRVPFRQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|