C19H23N3O4 — CID 11111085
(2S,3S)-3-azido-5,5-bis(phenylmethoxy)pentane-1,2-diol (PubChem CID 11111085) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2S,3S)-3-azido-5,5-bis(phenylmethoxy)pentane-1,2-diol.
| Compound Name | (2S,3S)-3-azido-5,5-bis(phenylmethoxy)pentane-1,2-diol |
|---|---|
| PubChem CID | 11111085 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2S,3S)-3-azido-5,5-bis(phenylmethoxy)pentane-1,2-diol |
| SMILES | [N-]=[N+]=N[C@@H](CC(OCc1ccccc1)OCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C19H23N3O4/c20-22-21-17(18(24)12-23)11-19(25-13-15-7-3-1-4-8-15)26-14-16-9-5-2-6-10-16/h1-10,17-19,23-24H,11-14H2/t17-,18+/m0/s1 |
| InChIKey | LWVXSPLKJPPZBB-ZWKOTPCHSA-N |
| XLogP | 3.17 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|