C20H38O4Si — CID 11111457
[(1R,2R,5R,6S)-5-acetyl-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethylcyclohexyl] acetate (PubChem CID 11111457) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is [(1R,2R,5R,6S)-5-acetyl-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethylcyclohexyl] acetate.
| Compound Name | [(1R,2R,5R,6S)-5-acetyl-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethylcyclohexyl] acetate |
|---|---|
| PubChem CID | 11111457 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | [(1R,2R,5R,6S)-5-acetyl-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](C)[C@H](C(C)=O)CC[C@]1(C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si/c1-14-17(15(2)21)10-11-20(7,18(14)24-16(3)22)12-13-23-25(8,9)19(4,5)6/h14,17-18H,10-13H2,1-9H3/t14-,17+,18+,20+/m0/s1 |
| InChIKey | DNSVWHXBTIKYMW-LMVHDODDSA-N |
| XLogP | 4.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|