C24H18F3N3 — CID 11112260
1-(1,3-diphenylpyrazol-4-yl)-N-[[2-(trifluoromethyl)phenyl]methyl]methanimine (PubChem CID 11112260) has the molecular formula C24H18F3N3 and a molecular weight of 405.42 g/mol. Its IUPAC name is 1-(1,3-diphenylpyrazol-4-yl)-N-[[2-(trifluoromethyl)phenyl]methyl]methanimine.
| Compound Name | 1-(1,3-diphenylpyrazol-4-yl)-N-[[2-(trifluoromethyl)phenyl]methyl]methanimine |
|---|---|
| PubChem CID | 11112260 |
| Molecular Formula | C24H18F3N3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-(1,3-diphenylpyrazol-4-yl)-N-[[2-(trifluoromethyl)phenyl]methyl]methanimine |
| SMILES | FC(F)(F)c1ccccc1C/N=C/c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H18F3N3/c25-24(26,27)22-14-8-7-11-19(22)15-28-16-20-17-30(21-12-5-2-6-13-21)29-23(20)18-9-3-1-4-10-18/h1-14,16-17H,15H2/b28-16+ |
| InChIKey | QOCMOYYRKFAKQF-LQKURTRISA-N |
| XLogP | 6.18 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|