C22H28N2O6 — CID 11112492
diethyl 2-acetamido-2-(5-indol-1-yl-5-oxopentyl)propanedioate (PubChem CID 11112492) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is diethyl 2-acetamido-2-(5-indol-1-yl-5-oxopentyl)propanedioate.
| Compound Name | diethyl 2-acetamido-2-(5-indol-1-yl-5-oxopentyl)propanedioate |
|---|---|
| PubChem CID | 11112492 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | diethyl 2-acetamido-2-(5-indol-1-yl-5-oxopentyl)propanedioate |
| SMILES | CCOC(=O)C(CCCCC(=O)n1ccc2ccccc21)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C22H28N2O6/c1-4-29-20(27)22(23-16(3)25,21(28)30-5-2)14-9-8-12-19(26)24-15-13-17-10-6-7-11-18(17)24/h6-7,10-11,13,15H,4-5,8-9,12,14H2,1-3H3,(H,23,25) |
| InChIKey | NQKOFRIUTRDZCW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|