C22H30N4O4S — CID 111141825
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111141825) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111141825 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCCOc1ccc(Oc2ncccc2C/N=C(\NCC)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C22H30N4O4S/c1-3-13-29-19-7-9-20(10-8-19)30-21-17(6-5-12-24-21)15-25-22(23-4-2)26-18-11-14-31(27,28)16-18/h5-10,12,18H,3-4,11,13-16H2,1-2H3,(H2,23,25,26) |
| InChIKey | YMWFOOFQQYISLJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|