C11H20ClN3 — CID 11117857
N-[2-(cyclohexen-1-yl)ethyl]-4,5-dihydro-1H-imidazol-3-ium-2-amine chloride (PubChem CID 11117857) has the molecular formula C11H20ClN3 and a molecular weight of 229.75 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4,5-dihydro-1H-imidazol-3-ium-2-amine chloride.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4,5-dihydro-1H-imidazol-3-ium-2-amine chloride |
|---|---|
| PubChem CID | 11117857 |
| Molecular Formula | C11H20ClN3 |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4,5-dihydro-1H-imidazol-3-ium-2-amine chloride |
| SMILES | C1=C(CCNC2=[NH+]CCN2)CCCC1.[Cl-] |
| InChI | InChI=1S/C11H19N3.ClH/c1-2-4-10(5-3-1)6-7-12-11-13-8-9-14-11;/h4H,1-3,5-9H2,(H2,12,13,14);1H |
| InChIKey | VTXQGWGZLNJGNR-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 38.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|