C17H31N3 — CID 10946943
N-[2-(cyclohexen-1-yl)ethyl]-5-hexyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 10946943) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-hexyl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-hexyl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 10946943 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-hexyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CCCCCCC1CN=C(NCCC2=CCCCC2)N1 |
| InChI | InChI=1S/C17H31N3/c1-2-3-4-8-11-16-14-19-17(20-16)18-13-12-15-9-6-5-7-10-15/h9,16H,2-8,10-14H2,1H3,(H2,18,19,20) |
| InChIKey | JNDABFOZTIVJFV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|