C17H32ClN3 — CID 10946942
N-[2-(cyclohexen-1-yl)ethyl]-5-hexyl-4,5-dihydro-1H-imidazol-3-ium-2-amine chloride (PubChem CID 10946942) has the molecular formula C17H32ClN3 and a molecular weight of 313.92 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-hexyl-4,5-dihydro-1H-imidazol-3-ium-2-amine chloride.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-hexyl-4,5-dihydro-1H-imidazol-3-ium-2-amine chloride |
|---|---|
| PubChem CID | 10946942 |
| Molecular Formula | C17H32ClN3 |
| Molecular Weight | 313.92 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-hexyl-4,5-dihydro-1H-imidazol-3-ium-2-amine chloride |
| SMILES | CCCCCCC1C[NH+]=C(NCCC2=CCCCC2)N1.[Cl-] |
| InChI | InChI=1S/C17H31N3.ClH/c1-2-3-4-8-11-16-14-19-17(20-16)18-13-12-15-9-6-5-7-10-15;/h9,16H,2-8,10-14H2,1H3,(H2,18,19,20);1H |
| InChIKey | CCTNIRXUZYNMHH-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 38.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.92 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|