C13H19NO3 — CID 11118079
(6R,7S,7aS)-6-acetyl-3,3-dimethyl-7-prop-2-enyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 11118079) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (6R,7S,7aS)-6-acetyl-3,3-dimethyl-7-prop-2-enyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6R,7S,7aS)-6-acetyl-3,3-dimethyl-7-prop-2-enyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 11118079 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (6R,7S,7aS)-6-acetyl-3,3-dimethyl-7-prop-2-enyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=CC[C@H]1[C@H](C(C)=O)C(=O)N2[C@@H]1COC2(C)C |
| InChI | InChI=1S/C13H19NO3/c1-5-6-9-10-7-17-13(3,4)14(10)12(16)11(9)8(2)15/h5,9-11H,1,6-7H2,2-4H3/t9-,10-,11+/m1/s1 |
| InChIKey | KMFMNDHCKCJXSM-MXWKQRLJSA-N |
| XLogP | 1.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|