C12H17NO2 — CID 134968088
(7S,7aS)-7-ethenylspiro[1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclopentane]-5-one (PubChem CID 134968088) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (7S,7aS)-7-ethenylspiro[1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclopentane]-5-one.
| Compound Name | (7S,7aS)-7-ethenylspiro[1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclopentane]-5-one |
|---|---|
| PubChem CID | 134968088 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (7S,7aS)-7-ethenylspiro[1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-3,1'-cyclopentane]-5-one |
| SMILES | C=C[C@@H]1CC(=O)N2[C@@H]1COC21CCCC1 |
| InChI | InChI=1S/C12H17NO2/c1-2-9-7-11(14)13-10(9)8-15-12(13)5-3-4-6-12/h2,9-10H,1,3-8H2/t9-,10-/m1/s1 |
| InChIKey | GWUCTGZVSADBPH-NXEZZACHSA-N |
| XLogP | 1.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|