C20H34O3 — CID 11120843
(2E,7S)-3,7,11-trimethyl-1-(oxan-2-yloxy)dodeca-2,10-dien-5-one (PubChem CID 11120843) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (2E,7S)-3,7,11-trimethyl-1-(oxan-2-yloxy)dodeca-2,10-dien-5-one.
| Compound Name | (2E,7S)-3,7,11-trimethyl-1-(oxan-2-yloxy)dodeca-2,10-dien-5-one |
|---|---|
| PubChem CID | 11120843 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2E,7S)-3,7,11-trimethyl-1-(oxan-2-yloxy)dodeca-2,10-dien-5-one |
| SMILES | CC(C)=CCC[C@H](C)CC(=O)C/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C20H34O3/c1-16(2)8-7-9-17(3)14-19(21)15-18(4)11-13-23-20-10-5-6-12-22-20/h8,11,17,20H,5-7,9-10,12-15H2,1-4H3/b18-11+/t17-,20?/m0/s1 |
| InChIKey | BULPOXWYYFBVJE-UTAYRFOGSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|