C19H29NO3Si — CID 11121580
(4S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one (PubChem CID 11121580) has the molecular formula C19H29NO3Si and a molecular weight of 347.53 g/mol. Its IUPAC name is (4S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11121580 |
| Molecular Formula | C19H29NO3Si |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (4S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1NC(=O)OC1/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H29NO3Si/c1-19(2,3)24(4,5)22-14-13-16-17(23-18(21)20-16)12-11-15-9-7-6-8-10-15/h6-12,16-17H,13-14H2,1-5H3,(H,20,21)/b12-11+/t16-,17?/m0/s1 |
| InChIKey | PWGNXMWNXUZLMZ-FSNYXLCYSA-N |
| XLogP | 4.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|