C16H10ClNO2S2 — CID 11121587
[4-(4-chlorophenyl)-2-sulfanylidene-1,3-thiazol-3-yl] benzoate (PubChem CID 11121587) has the molecular formula C16H10ClNO2S2 and a molecular weight of 347.85 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-2-sulfanylidene-1,3-thiazol-3-yl] benzoate.
| Compound Name | [4-(4-chlorophenyl)-2-sulfanylidene-1,3-thiazol-3-yl] benzoate |
|---|---|
| PubChem CID | 11121587 |
| Molecular Formula | C16H10ClNO2S2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | [4-(4-chlorophenyl)-2-sulfanylidene-1,3-thiazol-3-yl] benzoate |
| SMILES | O=C(On1c(-c2ccc(Cl)cc2)csc1=S)c1ccccc1 |
| InChI | InChI=1S/C16H10ClNO2S2/c17-13-8-6-11(7-9-13)14-10-22-16(21)18(14)20-15(19)12-4-2-1-3-5-12/h1-10H |
| InChIKey | RUOWAGBLNZLMHO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|