C20H15N7O6S — CID 11123679
N-[(5Z)-2-(2-nitrophenyl)-5-[(2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 11123679) has the molecular formula C20H15N7O6S and a molecular weight of 481.45 g/mol. Its IUPAC name is N-[(5Z)-2-(2-nitrophenyl)-5-[(2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(5Z)-2-(2-nitrophenyl)-5-[(2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 11123679 |
| Molecular Formula | C20H15N7O6S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | N-[(5Z)-2-(2-nitrophenyl)-5-[(2-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)NN1C(=O)/C(=C/c2ccccc2[N+](=O)[O-])SC1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15N7O6S/c28-18(10-24-12-21-11-22-24)23-25-19(29)17(9-13-5-1-3-7-15(13)26(30)31)34-20(25)14-6-2-4-8-16(14)27(32)33/h1-9,11-12,20H,10H2,(H,23,28)/b17-9- |
| InChIKey | KTUVANFOAHBDSP-MFOYZWKCSA-N |
| XLogP | 2.44 |
| TPSA | 166.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|